Difference between revisions of "CPD-15163"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C == * common-name: ** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * smiles: ** cc(o)(co)c(o)cop(op([o-])(...")
(Created page with "Category:metabolite == Metabolite Non-Glucur-Glucuronoside-Acceptors == * common-name: ** a non-glucuronated glucosyluronate acceptor == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C ==
+
== Metabolite Non-Glucur-Glucuronoside-Acceptors ==
 
* common-name:
 
* common-name:
** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
+
** a non-glucuronated glucosyluronate acceptor
* smiles:
 
** cc(o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
 
* inchi-key:
 
** yfaukwznpvbcff-xhibxcghsa-l
 
* molecular-weight:
 
** 519.295
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.148-RXN]]
+
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.60-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
+
{{#set: common-name=a non-glucuronated glucosyluronate acceptor}}
{{#set: inchi-key=inchikey=yfaukwznpvbcff-xhibxcghsa-l}}
 
{{#set: molecular-weight=519.295}}
 

Revision as of 13:09, 14 January 2021

Metabolite Non-Glucur-Glucuronoside-Acceptors

  • common-name:
    • a non-glucuronated glucosyluronate acceptor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality