Difference between revisions of "OLIGOSACCHARIDE-DIPHOSPHODOLICHOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite METHACRYLYL-COA == * common-name: ** methylacrylyl-coa * smiles: ** c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
(Created page with "Category:metabolite == Metabolite DL-12-Propanediol == * common-name: ** propane-1,2-diol == Reaction(s) known to consume the compound == * RXN-17622 == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite METHACRYLYL-COA ==
+
== Metabolite DL-12-Propanediol ==
 
* common-name:
 
* common-name:
** methylacrylyl-coa
+
** propane-1,2-diol
* smiles:
 
** c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
* inchi-key:
 
** npalueycdzwbov-ndzskpawsa-j
 
* molecular-weight:
 
** 831.577
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
+
* [[RXN-17622]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MCDH]]
+
* [[RXN-17617]]
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
+
* [[RXN-17622]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=methylacrylyl-coa}}
+
{{#set: common-name=propane-1,2-diol}}
{{#set: inchi-key=inchikey=npalueycdzwbov-ndzskpawsa-j}}
 
{{#set: molecular-weight=831.577}}
 

Revision as of 13:09, 14 January 2021

Metabolite DL-12-Propanediol

  • common-name:
    • propane-1,2-diol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality