Difference between revisions of "5-Phospho-terminated-DNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-CARBOXYVINYL-CARBOXYPHOSPHONATE == * common-name: ** 1-carboxyvinyl carboxyphosphonate * smiles: ** c=c(c([o-])=o)op(=o)(c(=o)[o-])[o-]...")
(Created page with "Category:metabolite == Metabolite CPD-17279 == * common-name: ** a [glycerolipid]-dicranin == Reaction(s) known to consume the compound == == Reaction(s) known to produce...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-CARBOXYVINYL-CARBOXYPHOSPHONATE ==
+
== Metabolite CPD-17279 ==
 
* common-name:
 
* common-name:
** 1-carboxyvinyl carboxyphosphonate
+
** a [glycerolipid]-dicranin
* smiles:
 
** c=c(c([o-])=o)op(=o)(c(=o)[o-])[o-]
 
* inchi-key:
 
** lpufgtsgsicqbx-uhfffaoysa-k
 
* molecular-weight:
 
** 193.029
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.8.23-RXN]]
 
* [[RXN-10827]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.8.23-RXN]]
+
* [[RXN-11682]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-carboxyvinyl carboxyphosphonate}}
+
{{#set: common-name=a [glycerolipid]-dicranin}}
{{#set: inchi-key=inchikey=lpufgtsgsicqbx-uhfffaoysa-k}}
 
{{#set: molecular-weight=193.029}}
 

Revision as of 13:09, 14 January 2021

Metabolite CPD-17279

  • common-name:
    • a [glycerolipid]-dicranin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-dicranin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.