Difference between revisions of "1-3-alpha-D-Glucans"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-IMIDAZOLEACETATE == * common-name: ** 4-imidazoleacetate * smiles: ** c1(nc=c(cc(=o)[o-])n=1) * inchi-key: ** prjknhomhkjcej-uhfffaoysa...") |
(Created page with "Category:metabolite == Metabolite CPD-19489 == * common-name: ** 3-isopropyl-8-(methylthio)-2-oxooctanoate * smiles: ** cscccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: ** y...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-19489 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-isopropyl-8-(methylthio)-2-oxooctanoate |
* smiles: | * smiles: | ||
− | ** | + | ** cscccccc(c(=o)c(=o)[o-])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** yobcouzbifvtfn-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 246.278 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-18204]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-18204]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-isopropyl-8-(methylthio)-2-oxooctanoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yobcouzbifvtfn-uhfffaoysa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=246.278}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite CPD-19489
- common-name:
- 3-isopropyl-8-(methylthio)-2-oxooctanoate
- smiles:
- cscccccc(c(=o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- yobcouzbifvtfn-uhfffaoysa-l
- molecular-weight:
- 246.278