Difference between revisions of "L-methionyl-glycyl-Protein"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Uracil16-in-tRNAs == * common-name: ** a uracil16 in trna == Reaction(s) known to consume the compound == * RXN-12454 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET == * common-name: ** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * smiles: ** cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol |
| + | * smiles: | ||
| + | ** cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o | ||
| + | * inchi-key: | ||
| + | ** htjxtkbiuvfuar-xhibxcghsa-j | ||
| + | * molecular-weight: | ||
| + | ** 597.259 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-302]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.7.1.148-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}} |
| + | {{#set: inchi-key=inchikey=htjxtkbiuvfuar-xhibxcghsa-j}} | ||
| + | {{#set: molecular-weight=597.259}} | ||
Revision as of 13:10, 14 January 2021
Contents
Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET
- common-name:
- 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
- smiles:
- cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
- inchi-key:
- htjxtkbiuvfuar-xhibxcghsa-j
- molecular-weight:
- 597.259
