Difference between revisions of "CPD-7830"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15431 == * common-name: ** n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-un...")
(Created page with "Category:metabolite == Metabolite Thiopurine-Methylethers == * common-name: ** a thiopurine s-methylether == Reaction(s) known to consume the compound == == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15431 ==
+
== Metabolite Thiopurine-Methylethers ==
 
* common-name:
 
* common-name:
** n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol
+
** a thiopurine s-methylether
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)([o-])op([o-])(=o)oc1(c(c(c(c(o1)co)o)oc2(oc(co)c(o)c(o)c(nc(=o)c)2))nc(c)=o))c)c)c)c)c)c)c
 
* inchi-key:
 
** sgclprbyahbrpd-qozjjacasa-l
 
* molecular-weight:
 
** 1331.648
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14561]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[THIOPURINE-S-METHYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol}}
+
{{#set: common-name=a thiopurine s-methylether}}
{{#set: inchi-key=inchikey=sgclprbyahbrpd-qozjjacasa-l}}
 
{{#set: molecular-weight=1331.648}}
 

Revision as of 13:10, 14 January 2021

Metabolite Thiopurine-Methylethers

  • common-name:
    • a thiopurine s-methylether

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality