Difference between revisions of "Glc2Man9GlcNAc2-proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SULFO-CYSTEINE == * common-name: ** s-sulfo-l-cysteine * smiles: ** c(c([n+])c(=o)[o-])ss([o-])(=o)=o * inchi-key: ** nokpbjyhphhwan-reoh...") |
(Created page with "Category:metabolite == Metabolite 3-Oxosteroids == * common-name: ** a 3-oxosteroid == Reaction(s) known to consume the compound == * RXN-13686 * RXN-13926 == Reac...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-Oxosteroids == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 3-oxosteroid |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13686]] |
| + | * [[RXN-13926]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13686]] |
| + | * [[RXN-13926]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 3-oxosteroid}} |
| − | |||
| − | |||
Revision as of 13:10, 14 January 2021
Contents
Metabolite 3-Oxosteroids
- common-name:
- a 3-oxosteroid
