Difference between revisions of "CPD-9873"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14123 == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c([n+])c(o)c(o)c(o)c(=o)1) * inchi-key: ** fsugckmutgkw...") |
(Created page with "Category:metabolite == Metabolite GLUCOSAMINYL-ETCETERA-MANNOSYL-R == * common-name: ** (n-acetyl-β-d-glucosaminyl-1,2)-α-d-mannosyl-1,3-(β-n-acetyl-d-gluc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GLUCOSAMINYL-ETCETERA-MANNOSYL-R == |
* common-name: | * common-name: | ||
| − | ** | + | ** (n-acetyl-β-d-glucosaminyl-1,2)-α-d-mannosyl-1,3-(β-n-acetyl-d-glucosaminyl-1,2-α-d-mannosyl-1,6)-β-d-mannosyl-r |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-7873]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7873]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(n-acetyl-β-d-glucosaminyl-1,2)-α-d-mannosyl-1,3-(β-n-acetyl-d-glucosaminyl-1,2-α-d-mannosyl-1,6)-β-d-mannosyl-r}} |
| − | |||
| − | |||
Revision as of 13:11, 14 January 2021
Contents
Metabolite GLUCOSAMINYL-ETCETERA-MANNOSYL-R
- common-name:
- (n-acetyl-β-d-glucosaminyl-1,2)-α-d-mannosyl-1,3-(β-n-acetyl-d-glucosaminyl-1,2-α-d-mannosyl-1,6)-β-d-mannosyl-r
