Difference between revisions of "CPD-15690"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-SULFINOALANINE == * common-name: ** 3-sulfinoalanine * smiles: ** c(c([n+])c(=o)[o-])s([o-])=o * inchi-key: ** advptqaunprnpo-reohclbhs...") |
(Created page with "Category:metabolite == Metabolite 3-Oxo-octanoyl-ACPs == * common-name: ** a 3-oxo-octanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9524 == Reactio...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite 3- | + | == Metabolite 3-Oxo-octanoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** 3- | + | ** a 3-oxo-octanoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9524]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9523]] |
| − | * [[ | + | * [[RXN-9650]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3- | + | {{#set: common-name=a 3-oxo-octanoyl-[acp]}} |
| − | |||
| − | |||
Revision as of 13:11, 14 January 2021
Contents
Metabolite 3-Oxo-octanoyl-ACPs
- common-name:
- a 3-oxo-octanoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 3-oxo-octanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
