Difference between revisions of "DIHYDROXYNAPHTHOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14596 == * common-name: ** neolinustatin * smiles: ** ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * inchi-key: ** wosy...") |
(Created page with "Category:metabolite == Metabolite 24-246-N-linked-Glycan == * common-name: ** a [(2,4),(2,4,6)]-n-linked glycan == Reaction(s) known to consume the compound == == Reaction...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 24-246-N-linked-Glycan == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [(2,4),(2,4,6)]-n-linked glycan |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.4.1.201-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [(2,4),(2,4,6)]-n-linked glycan}} |
| − | |||
| − | |||
Revision as of 13:11, 14 January 2021
Contents
Metabolite 24-246-N-linked-Glycan
- common-name:
- a [(2,4),(2,4,6)]-n-linked glycan
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [(2,4),(2,4,6)]-n-linked glycan" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
