Difference between revisions of "P261-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROKAEMPFEROL-CMPD DIHYDROKAEMPFEROL-CMPD] == * common-name: ** (+)-dihydrokaempferol * smi...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-pi-phospho-L-histidines Protein-pi-phospho-L-histidines] == * common-name: ** a [protei...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROKAEMPFEROL-CMPD DIHYDROKAEMPFEROL-CMPD] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-pi-phospho-L-histidines Protein-pi-phospho-L-histidines] ==
 
* common-name:
 
* common-name:
** (+)-dihydrokaempferol
+
** a [protein]-nπ-phospho-l-histidine
* smiles:
 
** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3)))
 
* inchi-key:
 
** padqinqhpqkxnl-lsdhhaiusa-n
 
* molecular-weight:
 
** 288.256
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
+
* [[RXN-15509]]
* [[RXN1F-93]]
+
* [[RXN-15510]]
 +
* [[RXN-15511]]
 +
* [[RXN-15512]]
 +
* [[RXN-17131]]
 +
* [[RXN-17276]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
+
* [[RXN-15509]]
 +
* [[RXN-15510]]
 +
* [[RXN-15511]]
 +
* [[RXN-15512]]
 +
* [[RXN-17274]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-dihydrokaempferol}}
+
{{#set: common-name=a [protein]-nπ-phospho-l-histidine}}
{{#set: inchi-key=inchikey=padqinqhpqkxnl-lsdhhaiusa-n}}
 
{{#set: molecular-weight=288.256}}
 

Revision as of 14:19, 26 August 2019

Metabolite Protein-pi-phospho-L-histidines

  • common-name:
    • a [protein]-nπ-phospho-l-histidine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-nπ-phospho-l-histidine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.