Difference between revisions of "CPD-12676"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == * common-name: ** 6-phospho d-glucono-1,5-lactone * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)...")
(Created page with "Category:metabolite == Metabolite 2-Palmitoyl-L-Phosphatidate == * common-name: ** a 1-acyl-2-palmitoyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-6-P-GLUCONO-DELTA-LACTONE ==
+
== Metabolite 2-Palmitoyl-L-Phosphatidate ==
 
* common-name:
 
* common-name:
** 6-phospho d-glucono-1,5-lactone
+
** a 1-acyl-2-palmitoyl-sn-glycerol 3-phosphate
* smiles:
 
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
 
* inchi-key:
 
** ijojivndfqsgab-sqougzdysa-l
 
* molecular-weight:
 
** 256.105
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[6PGLUCONOLACT-RXN]]
 
* [[RXN-14819]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[G6PADH]]
+
* [[RXN-16032]]
* [[G6PADHh]]
 
* [[G6PBDH]]
 
* [[G6PBDHh]]
 
* [[GLU6PDEHYDROG-RXN]]
 
* [[RXN-14819]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-phospho d-glucono-1,5-lactone}}
+
{{#set: common-name=a 1-acyl-2-palmitoyl-sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=ijojivndfqsgab-sqougzdysa-l}}
 
{{#set: molecular-weight=256.105}}
 

Revision as of 13:11, 14 January 2021

Metabolite 2-Palmitoyl-L-Phosphatidate

  • common-name:
    • a 1-acyl-2-palmitoyl-sn-glycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality