Difference between revisions of "CPD-10277"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-terminal-glycine == * common-name: ** an n-terminal glycyl-[protein] == Reaction(s) known to consume the compound == == Reaction(s) kno...") |
(Created page with "Category:metabolite == Metabolite CPD-4441 == * common-name: ** cis-zeatin * smiles: ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2)) * inchi-key: ** uzkqtcbamswpjd-uqcoibpssa-n * mol...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-4441 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cis-zeatin |
| + | * smiles: | ||
| + | ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2)) | ||
| + | * inchi-key: | ||
| + | ** uzkqtcbamswpjd-uqcoibpssa-n | ||
| + | * molecular-weight: | ||
| + | ** 219.246 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-4733]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cis-zeatin}} |
| + | {{#set: inchi-key=inchikey=uzkqtcbamswpjd-uqcoibpssa-n}} | ||
| + | {{#set: molecular-weight=219.246}} | ||
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-4441
- common-name:
- cis-zeatin
- smiles:
- cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))
- inchi-key:
- uzkqtcbamswpjd-uqcoibpssa-n
- molecular-weight:
- 219.246
