Difference between revisions of "CPD-9089"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15424 == * common-name: ** o-carbamoyladenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o * inch...") |
(Created page with "Category:metabolite == Metabolite XYLITOL == * common-name: ** xylitol * smiles: ** c(o)c(o)c(o)c(o)co * inchi-key: ** hebkchpvoiaqta-scdxwvjysa-n * molecular-weight: ** 1...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite XYLITOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** xylitol |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(o)c(o)c(o)c(o)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hebkchpvoiaqta-scdxwvjysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 152.147 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[1.1.3.41-RXN]] |
| − | * [[RXN | + | * [[L-XYLULOSE-REDUCTASE-RXN]] |
| − | * [[RXN- | + | * [[RXN-8773]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[L-XYLULOSE-REDUCTASE-RXN]] |
| + | * [[RXN-8773]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=xylitol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hebkchpvoiaqta-scdxwvjysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=152.147}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite XYLITOL
- common-name:
- xylitol
- smiles:
- c(o)c(o)c(o)c(o)co
- inchi-key:
- hebkchpvoiaqta-scdxwvjysa-n
- molecular-weight:
- 152.147
