Difference between revisions of "Menaquinones"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-Alpha-Linolenoyl-L-Phosphatidate == * common-name: ** a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to con...") |
(Created page with "Category:metabolite == Metabolite D-SEDOHEPTULOSE-1-7-P2 == * common-name: ** d-sedoheptulose-1,7-bisphosphate * smiles: ** c(op(=o)([o-])[o-])c(o)c(o)c(o)c(o)c(cop([o-])(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite D-SEDOHEPTULOSE-1-7-P2 == |
* common-name: | * common-name: | ||
− | ** | + | ** d-sedoheptulose-1,7-bisphosphate |
+ | * smiles: | ||
+ | ** c(op(=o)([o-])[o-])c(o)c(o)c(o)c(o)c(cop([o-])(=o)[o-])=o | ||
+ | * inchi-key: | ||
+ | ** okhxougreccasi-shuuezrqsa-j | ||
+ | * molecular-weight: | ||
+ | ** 366.112 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[SEDOBISALDOL-RXN]] | ||
+ | * [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[SEDOBISALDOL-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-sedoheptulose-1,7-bisphosphate}} |
+ | {{#set: inchi-key=inchikey=okhxougreccasi-shuuezrqsa-j}} | ||
+ | {{#set: molecular-weight=366.112}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite D-SEDOHEPTULOSE-1-7-P2
- common-name:
- d-sedoheptulose-1,7-bisphosphate
- smiles:
- c(op(=o)([o-])[o-])c(o)c(o)c(o)c(o)c(cop([o-])(=o)[o-])=o
- inchi-key:
- okhxougreccasi-shuuezrqsa-j
- molecular-weight:
- 366.112