Difference between revisions of "CPD-12121"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13534 == * common-name: ** 3-oxopentanoyl-coa * smiles: ** ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o...")
(Created page with "Category:metabolite == Metabolite CPD-19179 == * common-name: ** (8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13534 ==
+
== Metabolite CPD-19179 ==
 
* common-name:
 
* common-name:
** 3-oxopentanoyl-coa
+
** (8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
 
* smiles:
 
* smiles:
** ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c3(oc2(n1(c4(n=c(n)nc(=o)c(n[ch]1c(o)(c(o)2)3)=4))))
 
* inchi-key:
 
* inchi-key:
** wioqnwtzboqteu-zmhdxicwsa-j
+
** hrbcpxbjawppic-gzbygqqwsa-j
 
* molecular-weight:
 
* molecular-weight:
** 861.604
+
** 519.151
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12561]]
+
* [[RXN-17809]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12560]]
+
* [[RXN-8340]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxopentanoyl-coa}}
+
{{#set: common-name=(8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate}}
{{#set: inchi-key=inchikey=wioqnwtzboqteu-zmhdxicwsa-j}}
+
{{#set: inchi-key=inchikey=hrbcpxbjawppic-gzbygqqwsa-j}}
{{#set: molecular-weight=861.604}}
+
{{#set: molecular-weight=519.151}}

Revision as of 13:12, 14 January 2021

Metabolite CPD-19179

  • common-name:
    • (8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c3(oc2(n1(c4(n=c(n)nc(=o)c(n[ch]1c(o)(c(o)2)3)=4))))
  • inchi-key:
    • hrbcpxbjawppic-gzbygqqwsa-j
  • molecular-weight:
    • 519.151

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality