Difference between revisions of "3-OXOPALMITOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Thiocarboxylated-MPT-synthases == * common-name: ** a thiocarboxylated [small subunit of molybdopterin synthase] == Reaction(s) known to...")
(Created page with "Category:metabolite == Metabolite DGTP == * common-name: ** dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Thiocarboxylated-MPT-synthases ==
+
== Metabolite DGTP ==
 
* common-name:
 
* common-name:
** a thiocarboxylated [small subunit of molybdopterin synthase]
+
** dgtp
 +
* smiles:
 +
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 +
* inchi-key:
 +
** haazlughyhwqiw-kvqbguixsa-j
 +
* molecular-weight:
 +
** 503.152
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[DGTCY]]
 +
* [[DGTD]]
 +
* [[DGTPTRIPHYDRO-RXN]]
 +
* [[DGTPtm]]
 +
* [[DGTUP]]
 +
* [[RXN-14208]]
 +
* [[RXN-14217]]
 +
* [[RXN0-385]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12473]]
+
* [[ATDGD]]
 +
* [[DGDPKIN-RXN]]
 +
* [[DGTPtm]]
 +
* [[RXN-14207]]
 +
* [[RXN0-746]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a thiocarboxylated [small subunit of molybdopterin synthase]}}
+
{{#set: common-name=dgtp}}
 +
{{#set: inchi-key=inchikey=haazlughyhwqiw-kvqbguixsa-j}}
 +
{{#set: molecular-weight=503.152}}

Revision as of 13:12, 14 January 2021

Metabolite DGTP

  • common-name:
    • dgtp
  • smiles:
    • c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • haazlughyhwqiw-kvqbguixsa-j
  • molecular-weight:
    • 503.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality