Difference between revisions of "3-OXOPALMITOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Thiocarboxylated-MPT-synthases == * common-name: ** a thiocarboxylated [small subunit of molybdopterin synthase] == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite DGTP == * common-name: ** dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DGTP == |
* common-name: | * common-name: | ||
− | ** | + | ** dgtp |
+ | * smiles: | ||
+ | ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) | ||
+ | * inchi-key: | ||
+ | ** haazlughyhwqiw-kvqbguixsa-j | ||
+ | * molecular-weight: | ||
+ | ** 503.152 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[DGTCY]] | ||
+ | * [[DGTD]] | ||
+ | * [[DGTPTRIPHYDRO-RXN]] | ||
+ | * [[DGTPtm]] | ||
+ | * [[DGTUP]] | ||
+ | * [[RXN-14208]] | ||
+ | * [[RXN-14217]] | ||
+ | * [[RXN0-385]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ATDGD]] |
+ | * [[DGDPKIN-RXN]] | ||
+ | * [[DGTPtm]] | ||
+ | * [[RXN-14207]] | ||
+ | * [[RXN0-746]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dgtp}} |
+ | {{#set: inchi-key=inchikey=haazlughyhwqiw-kvqbguixsa-j}} | ||
+ | {{#set: molecular-weight=503.152}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite DGTP
- common-name:
- dgtp
- smiles:
- c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- haazlughyhwqiw-kvqbguixsa-j
- molecular-weight:
- 503.152