Difference between revisions of "CPD-13855"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7087 == * common-name: ** (+)-dihydromyricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite 3-OXOPALMITOYL-COA == * common-name: ** 3-oxo-palmitoyl-coa * smiles: ** cccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7087 ==
+
== Metabolite 3-OXOPALMITOYL-COA ==
 
* common-name:
 
* common-name:
** (+)-dihydromyricetin
+
** 3-oxo-palmitoyl-coa
 
* smiles:
 
* smiles:
** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o)
+
** cccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** kjxsixmjhkajod-lsdhhaiusa-m
+
** nqmplxpcrjoshl-bbecnahfsa-j
 
* molecular-weight:
 
* molecular-weight:
** 319.247
+
** 1015.898
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7784]]
+
* [[ACACT7]]
* [[RXN-8450]]
+
* [[HACD7h]]
 +
* [[RXN-14271]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7922]]
+
* [[ACACT7]]
 +
* [[ACACT7h]]
 +
* [[ACACT7m]]
 +
* [[HACD7h]]
 +
* [[RXN-14271]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-dihydromyricetin}}
+
{{#set: common-name=3-oxo-palmitoyl-coa}}
{{#set: inchi-key=inchikey=kjxsixmjhkajod-lsdhhaiusa-m}}
+
{{#set: inchi-key=inchikey=nqmplxpcrjoshl-bbecnahfsa-j}}
{{#set: molecular-weight=319.247}}
+
{{#set: molecular-weight=1015.898}}

Revision as of 13:12, 14 January 2021

Metabolite 3-OXOPALMITOYL-COA

  • common-name:
    • 3-oxo-palmitoyl-coa
  • smiles:
    • cccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • nqmplxpcrjoshl-bbecnahfsa-j
  • molecular-weight:
    • 1015.898

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality