Difference between revisions of "TRNA-uridine-38-39"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12826 == * common-name: ** folate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) * inch...") |
(Created page with "Category:metabolite == Metabolite CPD0-1308 == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o * inchi-key: ** xddaorkbjwwyjs-uhfffaoysa-l * molecular...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-1308 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glyphosate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(ncc(=o)[o-])p(o)([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xddaorkbjwwyjs-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 167.058 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17951]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glyphosate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xddaorkbjwwyjs-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=167.058}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD0-1308
- common-name:
- glyphosate
- smiles:
- c(ncc(=o)[o-])p(o)([o-])=o
- inchi-key:
- xddaorkbjwwyjs-uhfffaoysa-l
- molecular-weight:
- 167.058
