Difference between revisions of "Deoxyhypusine-Synthase-Lysine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cytochromes-C-Reduced == * common-name: ** a reduced c-type cytochrome == Reaction(s) known to consume the compound == * 1.10.2.2-RXN...") |
(Created page with "Category:metabolite == Metabolite REDUCED-MENAQUINONE == * common-name: ** menaquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite REDUCED-MENAQUINONE == |
* common-name: | * common-name: | ||
− | ** | + | ** menaquinol-8 |
+ | * smiles: | ||
+ | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(=cc=cc=c1c(o)=2)) | ||
+ | * inchi-key: | ||
+ | ** oiezrvbfvpgodt-wqwycsgdsa-n | ||
+ | * molecular-weight: | ||
+ | ** 719.144 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ADOMET-DMK-METHYLTRANSFER-RXN]] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=menaquinol-8}} |
+ | {{#set: inchi-key=inchikey=oiezrvbfvpgodt-wqwycsgdsa-n}} | ||
+ | {{#set: molecular-weight=719.144}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite REDUCED-MENAQUINONE
- common-name:
- menaquinol-8
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(=cc=cc=c1c(o)=2))
- inchi-key:
- oiezrvbfvpgodt-wqwycsgdsa-n
- molecular-weight:
- 719.144