Difference between revisions of "DIACYLGLYCEROL-PYROPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHENYL-PYRUVATE == * common-name: ** keto-phenylpyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cc=cc=c1) * inchi-key: ** btnmpgbkdvtsjy-uhfff...")
(Created page with "Category:metabolite == Metabolite CPD-415 == * common-name: ** a 1-long-chain acyl-glycerone 3-phosphate == Reaction(s) known to consume the compound == * ALKYLGLYCERONE...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHENYL-PYRUVATE ==
+
== Metabolite CPD-415 ==
 
* common-name:
 
* common-name:
** keto-phenylpyruvate
+
** a 1-long-chain acyl-glycerone 3-phosphate
* smiles:
 
** c([o-])(=o)c(=o)cc1(=cc=cc=c1)
 
* inchi-key:
 
** btnmpgbkdvtsjy-uhfffaoysa-m
 
* molecular-weight:
 
** 163.152
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.64-RXN]]
+
* [[ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN]]
* [[PHEAMINOTRANS-RXN]]
 
* [[PREPHENATEDEHYDRAT-RXN]]
 
* [[RXN-10814]]
 
* [[RXN-10815]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.64-RXN]]
+
* [[2.3.1.42-RXN]]
* [[PHEAMINOTRANS-RXN]]
 
* [[PPDH]]
 
* [[PREPHENATEDEHYDRAT-RXN]]
 
* [[RXN-10814]]
 
* [[RXN-17130]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=keto-phenylpyruvate}}
+
{{#set: common-name=a 1-long-chain acyl-glycerone 3-phosphate}}
{{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}}
 
{{#set: molecular-weight=163.152}}
 

Revision as of 13:12, 14 January 2021

Metabolite CPD-415

  • common-name:
    • a 1-long-chain acyl-glycerone 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality