Difference between revisions of "PWY0-1275"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == * common-name: ** 7,8-dihydromonapterin * smiles: ** c1(nc2(n=c(n)nc(=o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12117 CPD-12117] == * common-name: ** demethylmenaquinol-7 * smiles: ** cc(=cccc(c)=cccc(c)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12117 CPD-12117] == |
* common-name: | * common-name: | ||
− | ** 7 | + | ** demethylmenaquinol-7 |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ufzdimbxtvrbds-ssqlmynasa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 636.999 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-9191]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=7 | + | {{#set: common-name=demethylmenaquinol-7}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=636.999}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-12117
- common-name:
- demethylmenaquinol-7
- smiles:
- cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
- inchi-key:
- ufzdimbxtvrbds-ssqlmynasa-n
- molecular-weight:
- 636.999