Difference between revisions of "PWY0-1275"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == * common-name: ** 7,8-dihydromonapterin * smiles: ** c1(nc2(n=c(n)nc(=o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12117 CPD-12117] == * common-name: ** demethylmenaquinol-7 * smiles: ** cc(=cccc(c)=cccc(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12117 CPD-12117] ==
 
* common-name:
 
* common-name:
** 7,8-dihydromonapterin
+
** demethylmenaquinol-7
 
* smiles:
 
* smiles:
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
+
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
 
* inchi-key:
 
* inchi-key:
** yqifamynggotfb-njgyiypdsa-n
+
** ufzdimbxtvrbds-ssqlmynasa-n
 
* molecular-weight:
 
* molecular-weight:
** 255.233
+
** 636.999
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10857]]
+
* [[RXN-9191]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydromonapterin}}
+
{{#set: common-name=demethylmenaquinol-7}}
{{#set: inchi-key=inchikey=yqifamynggotfb-njgyiypdsa-n}}
+
{{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}}
{{#set: molecular-weight=255.233}}
+
{{#set: molecular-weight=636.999}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-12117

  • common-name:
    • demethylmenaquinol-7
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
  • inchi-key:
    • ufzdimbxtvrbds-ssqlmynasa-n
  • molecular-weight:
    • 636.999

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality