Difference between revisions of "NICOTINAMIDE RIBOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALCOHOL == * common-name: ** coniferyl alcohol * smiles: ** coc1(=cc(c=cco)=cc=c(o)1) * inchi-key: ** jmfrwrfflbvwsi-nscuhmnnsa...") |
(Created page with "Category:metabolite == Metabolite 23S-RRNA-N2-METHYLGUANINE2445 == * common-name: ** an n2-methylguanine2445 in 23s rrna == Reaction(s) known to consume the compound == ==...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 23S-RRNA-N2-METHYLGUANINE2445 == |
* common-name: | * common-name: | ||
− | ** | + | ** an n2-methylguanine2445 in 23s rrna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-11574]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an n2-methylguanine2445 in 23s rrna}} |
− | |||
− |
Revision as of 13:13, 14 January 2021
Contents
Metabolite 23S-RRNA-N2-METHYLGUANINE2445
- common-name:
- an n2-methylguanine2445 in 23s rrna