Difference between revisions of "Category:Metabolite"

From metabolic_network
Jump to navigation Jump to search
(Created page with "{{#ask: Category:pathway | ?common-name | ?nb reaction found | ?nb total reaction | ?completion rate |sort=completion rate, nb total reaction |order=descending }}")
(Created page with "Category:metabolite == Metabolite G3P == * common-name: ** 3-phospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(o)c(=o)[o-] * inchi-key: ** osjppgntcrnqqc-uwtatzphsa-k...")
Line 1: Line 1:
{{#ask: [[Category:pathway]]
+
[[Category:metabolite]]
| ?common-name
+
== Metabolite G3P ==
| ?nb reaction found
+
* common-name:
| ?nb total reaction
+
** 3-phospho-d-glycerate
| ?completion rate
+
* smiles:
|sort=completion rate, nb total reaction
+
** c(op(=o)([o-])[o-])c(o)c(=o)[o-]
|order=descending
+
* inchi-key:
}}
+
** osjppgntcrnqqc-uwtatzphsa-k
 +
* molecular-weight:
 +
** 183.034
 +
== Reaction(s) known to consume the compound ==
 +
* [[3PGAREARR-RXN]]
 +
* [[PGLYCDEHYDROG-RXN]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
* [[RXN-15511]]
 +
* [[RXN-15513]]
 +
* [[RXN-17276]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[3PGAREARR-RXN]]
 +
* [[GLY3KIN-RXN]]
 +
* [[PGLYCDEHYDROG-RXN]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
 +
* [[RXN-15511]]
 +
* [[RXN-15513]]
 +
* [[RXN-17274]]
 +
* [[RXN-3443]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=3-phospho-d-glycerate}}
 +
{{#set: inchi-key=inchikey=osjppgntcrnqqc-uwtatzphsa-k}}
 +
{{#set: molecular-weight=183.034}}

Revision as of 13:13, 14 January 2021

Metabolite G3P

  • common-name:
    • 3-phospho-d-glycerate
  • smiles:
    • c(op(=o)([o-])[o-])c(o)c(=o)[o-]
  • inchi-key:
    • osjppgntcrnqqc-uwtatzphsa-k
  • molecular-weight:
    • 183.034

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Pages in category "Metabolite"

The following 200 pages are in this category, out of 3,246 total.

(previous page) (next page)

K

(previous page) (next page)