Difference between revisions of "Digalactosylceramides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N1-MeAdenine57-MeAdenine58-tRNAs == * common-name: ** n1-methyladenine57/n1-methyladenine58 in trna == Reaction(s) known to consume the c...")
(Created page with "Category:metabolite == Metabolite CPD-14154 == * common-name: ** tobramycin * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N1-MeAdenine57-MeAdenine58-tRNAs ==
+
== Metabolite CPD-14154 ==
 
* common-name:
 
* common-name:
** n1-methyladenine57/n1-methyladenine58 in trna
+
** tobramycin
 +
* smiles:
 +
** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o)
 +
* inchi-key:
 +
** nlvfbuxfdbbnbw-pbsuhmdjsa-s
 +
* molecular-weight:
 +
** 472.558
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13168]]
 +
* [[RXN-15284]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12469]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n1-methyladenine57/n1-methyladenine58 in trna}}
+
{{#set: common-name=tobramycin}}
 +
{{#set: inchi-key=inchikey=nlvfbuxfdbbnbw-pbsuhmdjsa-s}}
 +
{{#set: molecular-weight=472.558}}

Revision as of 18:52, 14 January 2021

Metabolite CPD-14154

  • common-name:
    • tobramycin
  • smiles:
    • c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o)
  • inchi-key:
    • nlvfbuxfdbbnbw-pbsuhmdjsa-s
  • molecular-weight:
    • 472.558

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality