Difference between revisions of "DNA-Combined-With-Exogenous-DNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CREATINE-P == * common-name: ** nω-phosphocreatine * smiles: ** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+] * inchi-key: ** drbbfclwyr...") |
(Created page with "Category:metabolite == Metabolite OHyWstar-tRNA == * common-name: ** 7-(2-hydroxy-3-amino-3-carboxypropyl)-wyosine37 in trnaphe == Reaction(s) known to consume the compoun...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OHyWstar-tRNA == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7-(2-hydroxy-3-amino-3-carboxypropyl)-wyosine37 in trnaphe |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14539]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7-(2-hydroxy-3-amino-3-carboxypropyl)-wyosine37 in trnaphe}} |
| − | |||
| − | |||
Revision as of 18:52, 14 January 2021
Contents
Metabolite OHyWstar-tRNA
- common-name:
- 7-(2-hydroxy-3-amino-3-carboxypropyl)-wyosine37 in trnaphe
