Difference between revisions of "Aryl-sulfates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-396 == * common-name: ** 1-methylnicotinamide * smiles: ** c[n+]1(=cc=cc(=c1)c(=o)n) * inchi-key: ** ldhmavipbrsvrg-uhfffaoysa-o * mo...")
(Created page with "Category:metabolite == Metabolite 5-Methylcytosine-38-in-tRNAs == * common-name: ** a 5-methylcytosine38 in trna == Reaction(s) known to consume the compound == == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-396 ==
+
== Metabolite 5-Methylcytosine-38-in-tRNAs ==
 
* common-name:
 
* common-name:
** 1-methylnicotinamide
+
** a 5-methylcytosine38 in trna
* smiles:
 
** c[n+]1(=cc=cc(=c1)c(=o)n)
 
* inchi-key:
 
** ldhmavipbrsvrg-uhfffaoysa-o
 
* molecular-weight:
 
** 137.161
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]]
+
* [[RXN-11855]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-methylnicotinamide}}
+
{{#set: common-name=a 5-methylcytosine38 in trna}}
{{#set: inchi-key=inchikey=ldhmavipbrsvrg-uhfffaoysa-o}}
 
{{#set: molecular-weight=137.161}}
 

Revision as of 18:52, 14 January 2021

Metabolite 5-Methylcytosine-38-in-tRNAs

  • common-name:
    • a 5-methylcytosine38 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality