Difference between revisions of "CPD-8084"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite UTP == * common-name: ** utp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite LAUROYLCOA-CPD == * common-name: ** lauroyl-coa * smiles: ** cccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LAUROYLCOA-CPD == |
* common-name: | * common-name: | ||
− | ** | + | ** lauroyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** cccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ymcxghlsvalicc-gmhmeamdsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 945.808 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ACACT6]] |
− | * [[ | + | * [[ACACT6h]] |
− | * [[ | + | * [[ACOA120OR]] |
− | * [[ | + | * [[RXN-14262]] |
− | + | * [[RXN-9627]] | |
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ACACT6]] |
− | * [[ | + | * [[RXN-14262]] |
− | + | * [[RXN-14268]] | |
− | + | * [[RXN-16393]] | |
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | * [[ | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=lauroyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ymcxghlsvalicc-gmhmeamdsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=945.808}} |
Revision as of 18:53, 14 January 2021
Contents
Metabolite LAUROYLCOA-CPD
- common-name:
- lauroyl-coa
- smiles:
- cccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- ymcxghlsvalicc-gmhmeamdsa-j
- molecular-weight:
- 945.808