Difference between revisions of "CPD1F-133"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OCTADEC-9-ENE-118-DIOIC-ACID == * common-name: ** α,ω-9z-octadecenedioate * smiles: ** c(=o)([o-])cccccccc=ccccccccc(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite CPD-11540 == * common-name: ** udp-4-dehydro-β-l-rhamnose * smiles: ** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OCTADEC-9-ENE-118-DIOIC-ACID ==
+
== Metabolite CPD-11540 ==
 
* common-name:
 
* common-name:
** α,ω-9z-octadecenedioate
+
** udp-4-dehydro-β-l-rhamnose
 
* smiles:
 
* smiles:
** c(=o)([o-])cccccccc=ccccccccc(=o)[o-]
+
** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3)
 
* inchi-key:
 
* inchi-key:
** sblkviqsiheqof-uphrsurjsa-l
+
** ddwgqqadoimfoi-tyenrrdnsa-l
 
* molecular-weight:
 
* molecular-weight:
** 310.433
+
** 546.274
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16418]]
+
* [[RXN-10740]]
 +
* [[RXN-18332]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-18332]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α,ω-9z-octadecenedioate}}
+
{{#set: common-name=udp-4-dehydro-β-l-rhamnose}}
{{#set: inchi-key=inchikey=sblkviqsiheqof-uphrsurjsa-l}}
+
{{#set: inchi-key=inchikey=ddwgqqadoimfoi-tyenrrdnsa-l}}
{{#set: molecular-weight=310.433}}
+
{{#set: molecular-weight=546.274}}

Revision as of 18:53, 14 January 2021

Metabolite CPD-11540

  • common-name:
    • udp-4-dehydro-β-l-rhamnose
  • smiles:
    • cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3)
  • inchi-key:
    • ddwgqqadoimfoi-tyenrrdnsa-l
  • molecular-weight:
    • 546.274

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality