Difference between revisions of "CPD-13174"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14746 == * common-name: ** thiobenzoate * smiles: ** c(c1(c=cc=cc=1))(s)=o * inchi-key: ** uijgntrupzpvng-uhfffaoysa-n * molecular-we...")
(Created page with "Category:metabolite == Metabolite CPD-14394 == * common-name: ** (8z,11z,14z,17z)-icosa-8,11,14,17-tetraenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14746 ==
+
== Metabolite CPD-14394 ==
 
* common-name:
 
* common-name:
** thiobenzoate
+
** (8z,11z,14z,17z)-icosa-8,11,14,17-tetraenoyl-coa
 
* smiles:
 
* smiles:
** c(c1(c=cc=cc=1))(s)=o
+
** ccc=ccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** uijgntrupzpvng-uhfffaoysa-n
+
** plhicykopitjjt-qwoxclfssa-j
 
* molecular-weight:
 
* molecular-weight:
** 138.184
+
** 1049.959
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13725]]
+
* [[RXN-16042]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiobenzoate}}
+
{{#set: common-name=(8z,11z,14z,17z)-icosa-8,11,14,17-tetraenoyl-coa}}
{{#set: inchi-key=inchikey=uijgntrupzpvng-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=plhicykopitjjt-qwoxclfssa-j}}
{{#set: molecular-weight=138.184}}
+
{{#set: molecular-weight=1049.959}}

Revision as of 18:53, 14 January 2021

Metabolite CPD-14394

  • common-name:
    • (8z,11z,14z,17z)-icosa-8,11,14,17-tetraenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • plhicykopitjjt-qwoxclfssa-j
  • molecular-weight:
    • 1049.959

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality