Difference between revisions of "Ubiquitin-carrier-protein-E2-L-cysteine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17399 == * common-name: ** a [glycerolipid]-auricolate == Reaction(s) known to consume the compound == * RXN-16157 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP == * common-name: ** 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine * smiles: ** cc1(n=c(n)c(=cn=...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine |
+ | * smiles: | ||
+ | ** cc1(n=c(n)c(=cn=1)cop(op([o-])([o-])=o)([o-])=o) | ||
+ | * inchi-key: | ||
+ | ** agqjqcfepuvxnk-uhfffaoysa-k | ||
+ | * molecular-weight: | ||
+ | ** 296.093 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12610]] |
+ | * [[RXN-12611]] | ||
+ | * [[THI-P-SYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PYRIMSYN3-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-amino-2-methyl-5-(diphosphomethyl)pyrimidine}} |
+ | {{#set: inchi-key=inchikey=agqjqcfepuvxnk-uhfffaoysa-k}} | ||
+ | {{#set: molecular-weight=296.093}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP
- common-name:
- 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine
- smiles:
- cc1(n=c(n)c(=cn=1)cop(op([o-])([o-])=o)([o-])=o)
- inchi-key:
- agqjqcfepuvxnk-uhfffaoysa-k
- molecular-weight:
- 296.093