Difference between revisions of "2-DEOXY-D-GLUCOSE-6-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P == * common-name: ** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate * smiles: ** c1(op([o-])...")
(Created page with "Category:metabolite == Metabolite CPD-12601 == * common-name: ** β-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o)o1) * inchi-key: ** wqzgkkkjijffok-rwopyejcsa-n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P ==
+
== Metabolite CPD-12601 ==
 
* common-name:
 
* common-name:
−
** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate
+
** β-d-mannopyranose
 
* smiles:
 
* smiles:
−
** c1(op([o-])([o-])=o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** c(o)c1(c(o)c(o)c(o)c(o)o1)
 
* inchi-key:
 
* inchi-key:
−
** uphpwxpnziozjl-kxxvrosksa-a
+
** wqzgkkkjijffok-rwopyejcsa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 726.913
+
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[2.7.4.24-RXN]]
+
* [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]]
−
* [[RXN-10964]]
 
−
* [[RXN-10965]]
 
−
* [[RXN-10979]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[2.7.1.152-RXN]]
 
−
* [[RXN-10965]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate}}
+
{{#set: common-name=β-d-mannopyranose}}
−
{{#set: inchi-key=inchikey=uphpwxpnziozjl-kxxvrosksa-a}}
+
{{#set: inchi-key=inchikey=wqzgkkkjijffok-rwopyejcsa-n}}
−
{{#set: molecular-weight=726.913}}
+
{{#set: molecular-weight=180.157}}

Revision as of 18:54, 14 January 2021

Metabolite CPD-12601

  • common-name:
    • β-d-mannopyranose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o)o1)
  • inchi-key:
    • wqzgkkkjijffok-rwopyejcsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-DEOXY-D-GLUCOSE-6-PHOSPHATE&oldid=98505"