Difference between revisions of "5-DIPHOSPHO-1D-MYO-INOSITOL-12346P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BUTYRIC_ACID == * common-name: ** butanoate * smiles: ** cccc(=o)[o-] * inchi-key: ** feriucnnqqjtoy-uhfffaoysa-m * molecular-weight: **...") |
(Created page with "Category:metabolite == Metabolite CPD-19157 == * common-name: ** 3-oxo-(7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19157 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-oxo-(7z)-tetradecenoyl-coa |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bepllrgjvxaeji-twafkmgksa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 985.829 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17795]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17794]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-oxo-(7z)-tetradecenoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bepllrgjvxaeji-twafkmgksa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=985.829}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-19157
- common-name:
- 3-oxo-(7z)-tetradecenoyl-coa
- smiles:
- ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- bepllrgjvxaeji-twafkmgksa-j
- molecular-weight:
- 985.829
