Difference between revisions of "CPD-4203"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18550 == * common-name: ** quinoxaline-2-carboxyl adenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=...")
(Created page with "Category:metabolite == Metabolite Light == * common-name: ** hν == Reaction(s) known to consume the compound == * DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN * ExchangeS...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18550 ==
+
== Metabolite Light ==
 
* common-name:
 
* common-name:
** quinoxaline-2-carboxyl adenylate
+
** hν
* smiles:
 
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o
 
* inchi-key:
 
** vmjweicpcdrxql-scfuhwhpsa-m
 
* molecular-weight:
 
** 502.359
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17155]]
+
* [[DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN]]
 +
* [[ExchangeSeed-Light]]
 +
* [[PSII-RXN]]
 +
* [[RXN-5285]]
 +
* [[RXN1F-10]]
 +
* [[TransportSeed-Light]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ExchangeSeed-Light]]
 +
* [[TransportSeed-Light]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=quinoxaline-2-carboxyl adenylate}}
+
{{#set: common-name=hν}}
{{#set: inchi-key=inchikey=vmjweicpcdrxql-scfuhwhpsa-m}}
 
{{#set: molecular-weight=502.359}}
 

Revision as of 18:54, 14 January 2021