Difference between revisions of "CPD-4081"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD66-27 == * common-name: ** pregn-5-ene-3,20-dione-17-ol * smiles: ** cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4)) * inchi...")
(Created page with "Category:metabolite == Metabolite ACP == * common-name: ** a holo-[acyl-carrier protein] == Reaction(s) known to consume the compound == * 2.3.1.41-RXN * 3.1.4.14-RX...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD66-27 ==
+
== Metabolite ACP ==
 
* common-name:
 
* common-name:
** pregn-5-ene-3,20-dione-17-ol
+
** a holo-[acyl-carrier protein]
* smiles:
 
** cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4))
 
* inchi-key:
 
** rcfjdvcranozel-uhfffaoysa-n
 
* molecular-weight:
 
** 330.466
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-350]]
+
* [[2.3.1.41-RXN]]
 +
* [[3.1.4.14-RXN]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 +
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 +
* [[RXN-17155]]
 +
* [[RXN3O-8214]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-350]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]]
 +
* [[2.3.1.179-RXN]]
 +
* [[2.3.1.41-RXN]]
 +
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 +
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 +
* [[3.1.2.21-RXN]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 +
* [[HOLO-ACP-SYNTH-RXN]]
 +
* [[RXN-10462]]
 +
* [[RXN-10654]]
 +
* [[RXN-10658]]
 +
* [[RXN-10727]]
 +
* [[RXN-11474]]
 +
* [[RXN-11479]]
 +
* [[RXN-11797]]
 +
* [[RXN-13037]]
 +
* [[RXN-16024]]
 +
* [[RXN-16025]]
 +
* [[RXN-16067]]
 +
* [[RXN-16076]]
 +
* [[RXN-16077]]
 +
* [[RXN-16615]]
 +
* [[RXN-16621]]
 +
* [[RXN-16625]]
 +
* [[RXN-16629]]
 +
* [[RXN-17012]]
 +
* [[RXN-17013]]
 +
* [[RXN-17014]]
 +
* [[RXN-17015]]
 +
* [[RXN-17016]]
 +
* [[RXN-17017]]
 +
* [[RXN-17018]]
 +
* [[RXN-17020]]
 +
* [[RXN-17022]]
 +
* [[RXN-17024]]
 +
* [[RXN-8391]]
 +
* [[RXN-9516]]
 +
* [[RXN-9523]]
 +
* [[RXN-9527]]
 +
* [[RXN-9531]]
 +
* [[RXN-9535]]
 +
* [[RXN-9539]]
 +
* [[RXN-9548]]
 +
* [[RXN-9549]]
 +
* [[RXN0-2141]]
 +
* [[RXN0-5514]]
 +
* [[RXN0-6705]]
 +
* [[RXN0-947]]
 +
* [[RXN3O-1803]]
 +
* [[RXN3O-5304]]
 +
* [[RXN3O-8214]]
 +
* [[RXN3O-9780]]
 +
* [[UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pregn-5-ene-3,20-dione-17-ol}}
+
{{#set: common-name=a holo-[acyl-carrier protein]}}
{{#set: inchi-key=inchikey=rcfjdvcranozel-uhfffaoysa-n}}
 
{{#set: molecular-weight=330.466}}
 

Revision as of 18:54, 14 January 2021