Difference between revisions of "S-NITROSOGLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIMETHYLAMINE == * common-name: ** dimethylamine * smiles: ** c[n+]c * inchi-key: ** rosdsfdqcjngol-uhfffaoysa-o * molecular-weight: ** 4...")
(Created page with "Category:metabolite == Metabolite CPD-17387 == * common-name: ** (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIMETHYLAMINE ==
+
== Metabolite CPD-17387 ==
 
* common-name:
 
* common-name:
** dimethylamine
+
** (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
 
* smiles:
 
* smiles:
** c[n+]c
+
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** rosdsfdqcjngol-uhfffaoysa-o
+
** jjcguwrdulvwqg-drxnpijbsa-j
 
* molecular-weight:
 
* molecular-weight:
** 46.092
+
** 1118.034
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIMETHYLARGININASE-RXN]]
+
* [[RXN-16135]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dimethylamine}}
+
{{#set: common-name=(3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
{{#set: inchi-key=inchikey=rosdsfdqcjngol-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=jjcguwrdulvwqg-drxnpijbsa-j}}
{{#set: molecular-weight=46.092}}
+
{{#set: molecular-weight=1118.034}}

Revision as of 18:54, 14 January 2021

Metabolite CPD-17387

  • common-name:
    • (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • jjcguwrdulvwqg-drxnpijbsa-j
  • molecular-weight:
    • 1118.034

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality