Difference between revisions of "CPD-11592"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-aspartyl-tRNAAsn == * common-name: ** an l-aspartyl-[trnaasn] == Reaction(s) known to consume the compound == * 6.3.5.6-RXN == Reac...") |
(Created page with "Category:metabolite == Metabolite TAGATOSE-1-6-DIPHOSPHATE == * common-name: ** d-tagatofuranose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TAGATOSE-1-6-DIPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-tagatofuranose 1,6-bisphosphate |
| + | * smiles: | ||
| + | ** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o) | ||
| + | * inchi-key: | ||
| + | ** rnbgygvwrkecfj-oexcpvawsa-j | ||
| + | * molecular-weight: | ||
| + | ** 336.085 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[TAGAALDOL-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[TAGAKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-tagatofuranose 1,6-bisphosphate}} |
| + | {{#set: inchi-key=inchikey=rnbgygvwrkecfj-oexcpvawsa-j}} | ||
| + | {{#set: molecular-weight=336.085}} | ||
Revision as of 18:54, 14 January 2021
Contents
Metabolite TAGATOSE-1-6-DIPHOSPHATE
- common-name:
- d-tagatofuranose 1,6-bisphosphate
- smiles:
- c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o)
- inchi-key:
- rnbgygvwrkecfj-oexcpvawsa-j
- molecular-weight:
- 336.085
