Difference between revisions of "Cis-vaccenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CDP == * common-name: ** cdp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** zwiadyzpowu...")
(Created page with "Category:metabolite == Metabolite DL-12-Propanediol == * common-name: ** propane-1,2-diol == Reaction(s) known to consume the compound == * RXN-17622 == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CDP ==
+
== Metabolite DL-12-Propanediol ==
 
* common-name:
 
* common-name:
** cdp
+
** propane-1,2-diol
* smiles:
 
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
 
* inchi-key:
 
** zwiadyzpowuwew-xvfcmesisa-k
 
* molecular-weight:
 
** 400.155
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATCD]]
+
* [[RXN-17622]]
* [[ATCDm]]
 
* [[CDPKIN-RXN]]
 
* [[CDPREDUCT-RXN]]
 
* [[DCDT]]
 
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
 
* [[RXN-12198]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATCM]]
+
* [[RXN-17617]]
* [[DOLICHOL-KINASE-RXN]]
+
* [[RXN-17622]]
* [[RXN-11832]]
 
* [[RXN-12195]]
 
* [[RXN-12959]]
 
* [[RXN-15091]]
 
* [[RXN-7683]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cdp}}
+
{{#set: common-name=propane-1,2-diol}}
{{#set: inchi-key=inchikey=zwiadyzpowuwew-xvfcmesisa-k}}
 
{{#set: molecular-weight=400.155}}
 

Revision as of 18:55, 14 January 2021

Metabolite DL-12-Propanediol

  • common-name:
    • propane-1,2-diol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality