Difference between revisions of "G-protein-coupled-receptors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-239 == * common-name: ** cysteamine * smiles: ** c(cs)[n+] * inchi-key: ** ufulayfcsouiov-uhfffaoysa-o * molecular-weight: ** 78.152...")
(Created page with "Category:metabolite == Metabolite CPD-13713 == * common-name: ** adenosine 5'-phosphoselenate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-239 ==
+
== Metabolite CPD-13713 ==
 
* common-name:
 
* common-name:
** cysteamine
+
** adenosine 5'-phosphoselenate
 
* smiles:
 
* smiles:
** c(cs)[n+]
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](=o)(=o)o
 
* inchi-key:
 
* inchi-key:
** ufulayfcsouiov-uhfffaoysa-o
+
** xcadvmzzfpierr-kqynxxcusa-m
 
* molecular-weight:
 
* molecular-weight:
** 78.152
+
** 473.174
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYSTEAMINE-DIOXYGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12720]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cysteamine}}
+
{{#set: common-name=adenosine 5'-phosphoselenate}}
{{#set: inchi-key=inchikey=ufulayfcsouiov-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=xcadvmzzfpierr-kqynxxcusa-m}}
{{#set: molecular-weight=78.152}}
+
{{#set: molecular-weight=473.174}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-13713

  • common-name:
    • adenosine 5'-phosphoselenate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](=o)(=o)o
  • inchi-key:
    • xcadvmzzfpierr-kqynxxcusa-m
  • molecular-weight:
    • 473.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality