Difference between revisions of "CPD-9858"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Propionyl-CoA-CO2-ligases == * common-name: ** [propionyl-coa:carbon-dioxide ligase (adp-forming)] == Reaction(s) known to consume the co...") |
(Created page with "Category:metabolite == Metabolite CPD-9007 == * common-name: ** adp ribose 1'',2''-cyclic phosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-9007 == |
* common-name: | * common-name: | ||
− | ** | + | ** adp ribose 1'',2''-cyclic phosphate |
+ | * smiles: | ||
+ | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])occ5(c(o)c4(c(op([o-])(=o)o4)o5)))([o-])=o | ||
+ | * inchi-key: | ||
+ | ** npspryxpogpcpm-tyasjmozsa-k | ||
+ | * molecular-weight: | ||
+ | ** 618.26 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.7.1.160-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=adp ribose 1'',2''-cyclic phosphate}} |
+ | {{#set: inchi-key=inchikey=npspryxpogpcpm-tyasjmozsa-k}} | ||
+ | {{#set: molecular-weight=618.26}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite CPD-9007
- common-name:
- adp ribose 1,2-cyclic phosphate
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])occ5(c(o)c4(c(op([o-])(=o)o4)o5)))([o-])=o
- inchi-key:
- npspryxpogpcpm-tyasjmozsa-k
- molecular-weight:
- 618.26