Difference between revisions of "D-MYO-INOSITOL-1-MONOPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYADENOSINE == * common-name: ** 2'-deoxyadenosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-key: ** olxzpdwkrny...") |
(Created page with "Category:metabolite == Metabolite SEPO3 == * common-name: ** selenophosphate * smiles: ** [o-]p([o-])(o)=[se] * inchi-key: ** jrphgdyskgjtkz-uhfffaoysa-l * molecular-weigh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SEPO3 == |
* common-name: | * common-name: | ||
| − | ** | + | ** selenophosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** [o-]p([o-])(o)=[se] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jrphgdyskgjtkz-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 158.94 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10039]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.7.9.3-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=selenophosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jrphgdyskgjtkz-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=158.94}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite SEPO3
- common-name:
- selenophosphate
- smiles:
- [o-]p([o-])(o)=[se]
- inchi-key:
- jrphgdyskgjtkz-uhfffaoysa-l
- molecular-weight:
- 158.94
