Difference between revisions of "DNA-with-mismatch"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N1-METHYLADENINE == * common-name: ** n1-methyladenine * smiles: ** cn2(c=nc1(c(n=cn=1)=c(n)2)) * inchi-key: ** hpzmwtnatzpbih-uhfffaoysa...") |
(Created page with "Category:metabolite == Metabolite BENZALDEHYDE == * common-name: ** benzaldehyde * smiles: ** c(=o)c1(=cc=cc=c1) * inchi-key: ** humnylrzrppjdn-uhfffaoysa-n * molecular-we...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite BENZALDEHYDE == |
* common-name: | * common-name: | ||
− | ** | + | ** benzaldehyde |
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)c1(=cc=cc=c1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** humnylrzrppjdn-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 106.124 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=benzaldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=humnylrzrppjdn-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=106.124}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite BENZALDEHYDE
- common-name:
- benzaldehyde
- smiles:
- c(=o)c1(=cc=cc=c1)
- inchi-key:
- humnylrzrppjdn-uhfffaoysa-n
- molecular-weight:
- 106.124