Difference between revisions of "BENZALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACETYL-ETCETERA-L-ASPARAGINE == * common-name: ** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine * smiles: ** cc(=o)nc1(c(o)c(o)c(co)oc...")
(Created page with "Category:metabolite == Metabolite Beta-L-arabinosides == * common-name: ** an oligosaccharide with β-l-arabinopyranose at the non-reducing end == Reaction(s) known to...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACETYL-ETCETERA-L-ASPARAGINE ==
+
== Metabolite Beta-L-arabinosides ==
 
* common-name:
 
* common-name:
** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine
+
** an oligosaccharide with β-l-arabinopyranose at the non-reducing end
* smiles:
 
** cc(=o)nc1(c(o)c(o)c(co)oc(nc(=o)cc([n+])c(=o)[o-])1)
 
* inchi-key:
 
** yttrpbwemmpysw-hrrfrdkfsa-n
 
* molecular-weight:
 
** 335.313
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.5.1.26-RXN]]
+
* [[BETA-L-ARABINOSIDASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine}}
+
{{#set: common-name=an oligosaccharide with β-l-arabinopyranose at the non-reducing end}}
{{#set: inchi-key=inchikey=yttrpbwemmpysw-hrrfrdkfsa-n}}
 
{{#set: molecular-weight=335.313}}
 

Revision as of 18:55, 14 January 2021

Metabolite Beta-L-arabinosides

  • common-name:
    • an oligosaccharide with β-l-arabinopyranose at the non-reducing end

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality