Difference between revisions of "Uracil16-in-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SHIKIMATE == * common-name: ** shikimate * smiles: ** c1(=c(cc(c(o)c(o)1)o)c(=o)[o-]) * inchi-key: ** jxohggnkmltubp-hsuxutppsa-m * molec...") |
(Created page with "Category:metabolite == Metabolite CPD-4101 == * common-name: ** 24-methylenelophenol * smiles: ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(c(c)c(o)ccc(c)1[ch]2ccc(c)34)))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-4101 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 24-methylenelophenol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(c(c)c(o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rsmkyrdccsnyfm-aagdoflisa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 412.698 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[2.1.1.143-RXN]] |
| − | * [[ | + | * [[RXN-22199]] |
| + | * [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=24-methylenelophenol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rsmkyrdccsnyfm-aagdoflisa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=412.698}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite CPD-4101
- common-name:
- 24-methylenelophenol
- smiles:
- cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(c(c)c(o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- rsmkyrdccsnyfm-aagdoflisa-n
- molecular-weight:
- 412.698
