Difference between revisions of "Protein-L-Ser-or-L-Thr-P-L-Pro"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9175 == * common-name: ** n-acetyl-l-cysteine * smiles: ** cc(nc(c(=o)[o-])cs)=o * inchi-key: ** pwkskimoespyia-bypyzucnsa-m * molecu...")
(Created page with "Category:metabolite == Metabolite CPD-7214 == * common-name: ** (2s)-dihydrotricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9175 ==
+
== Metabolite CPD-7214 ==
 
* common-name:
 
* common-name:
** n-acetyl-l-cysteine
+
** (2s)-dihydrotricetin
 
* smiles:
 
* smiles:
** cc(nc(c(=o)[o-])cs)=o
+
** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o)
 
* inchi-key:
 
* inchi-key:
** pwkskimoespyia-bypyzucnsa-m
+
** usqxpewrywrrjd-lbprgkrzsa-m
 
* molecular-weight:
 
* molecular-weight:
** 162.183
+
** 303.248
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13868]]
+
* [[RXN-7922]]
* [[RXN-15414]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-l-cysteine}}
+
{{#set: common-name=(2s)-dihydrotricetin}}
{{#set: inchi-key=inchikey=pwkskimoespyia-bypyzucnsa-m}}
+
{{#set: inchi-key=inchikey=usqxpewrywrrjd-lbprgkrzsa-m}}
{{#set: molecular-weight=162.183}}
+
{{#set: molecular-weight=303.248}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-7214

  • common-name:
    • (2s)-dihydrotricetin
  • smiles:
    • c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o)
  • inchi-key:
    • usqxpewrywrrjd-lbprgkrzsa-m
  • molecular-weight:
    • 303.248

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality