Difference between revisions of "3Z-PHYTOCHROMOBILIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-D-GLUCOSAMINE-16-BIS-P == * common-name: ** n-acetyl-d-glucosamine 1,6-bisphosphate == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite 3Z-PHYTOCHROMOBILIN == * common-name: ** (3z)-phytochromobilin * smiles: ** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-ACETYL-D-GLUCOSAMINE-16-BIS-P ==
+
== Metabolite 3Z-PHYTOCHROMOBILIN ==
 
* common-name:
 
* common-name:
** n-acetyl-d-glucosamine 1,6-bisphosphate
+
** (3z)-phytochromobilin
 +
* smiles:
 +
** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
 +
* inchi-key:
 +
** dkmlmzvdtgoegu-aikfxvfzsa-l
 +
* molecular-weight:
 +
** 582.655
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16426]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16425]]
+
* [[1.3.7.4-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-d-glucosamine 1,6-bisphosphate}}
+
{{#set: common-name=(3z)-phytochromobilin}}
 +
{{#set: inchi-key=inchikey=dkmlmzvdtgoegu-aikfxvfzsa-l}}
 +
{{#set: molecular-weight=582.655}}

Revision as of 18:56, 14 January 2021

Metabolite 3Z-PHYTOCHROMOBILIN

  • common-name:
    • (3z)-phytochromobilin
  • smiles:
    • cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
  • inchi-key:
    • dkmlmzvdtgoegu-aikfxvfzsa-l
  • molecular-weight:
    • 582.655

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality