Difference between revisions of "Phosphoserines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9871 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite PROTEIN-LIPOYLLYSINE == * common-name: ** a [glycine-cleavage complex h protein] n6-lipoyl-l-lysine == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9871 ==
+
== Metabolite PROTEIN-LIPOYLLYSINE ==
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
+
** a [glycine-cleavage complex h protein] n6-lipoyl-l-lysine
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
** xcoxsblqzpfvgk-rgiwonjesa-n
 
* molecular-weight:
 
** 835.347
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GCVP-RXN]]
 +
* [[RXN-8629]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9235]]
+
* [[GCVP-RXN]]
 +
* [[RXN-13039]]
 +
* [[RXN-14950]]
 +
* [[RXN-8629]]
 +
* [[RXN0-1141]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=a [glycine-cleavage complex h protein] n6-lipoyl-l-lysine}}
{{#set: inchi-key=inchikey=xcoxsblqzpfvgk-rgiwonjesa-n}}
 
{{#set: molecular-weight=835.347}}
 

Revision as of 18:56, 14 January 2021

Metabolite PROTEIN-LIPOYLLYSINE

  • common-name:
    • a [glycine-cleavage complex h protein] n6-lipoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycine-cleavage complex h protein] n6-lipoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.