Difference between revisions of "METHYLBUT-CPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13118 == * common-name: ** gdp-β-l-fucose * smiles: ** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([...")
(Created page with "Category:metabolite == Metabolite MAP-Kinase-L-Phosphothreonine == * common-name: ** a [mitogen-activated protein kinase] l-threonine phosphate == Reaction(s) known to con...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13118 ==
+
== Metabolite MAP-Kinase-L-Phosphothreonine ==
 
* common-name:
 
* common-name:
** gdp-β-l-fucose
+
** a [mitogen-activated protein kinase] l-threonine phosphate
* smiles:
 
** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
 
* inchi-key:
 
** lqebexmhblqmdb-jgqubwhwsa-l
 
* molecular-weight:
 
** 587.33
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.221-RXN]]
+
* [[2.7.12.2-RXN]]
* [[2.4.1.68-RXN]]
 
* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
 
* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]]
 
* [[RXN-9463]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.271-RXN]]
+
* [[2.7.12.2-RXN]]
* [[2.4.1.221-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-β-l-fucose}}
+
{{#set: common-name=a [mitogen-activated protein kinase] l-threonine phosphate}}
{{#set: inchi-key=inchikey=lqebexmhblqmdb-jgqubwhwsa-l}}
 
{{#set: molecular-weight=587.33}}
 

Revision as of 18:56, 14 January 2021

Metabolite MAP-Kinase-L-Phosphothreonine

  • common-name:
    • a [mitogen-activated protein kinase] l-threonine phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [mitogen-activated protein kinase] l-threonine phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.