Difference between revisions of "Guanine26-Guanine27-in-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-320 == * common-name: ** ethylnitronate * smiles: ** cc=n(=o)[o-] * inchi-key: ** yerbbvnyiklxdm-uhfffaoysa-n * molecular-weight: **...")
(Created page with "Category:metabolite == Metabolite MI-HEXAKISPHOSPHATE == * common-name: ** phytate * smiles: ** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-320 ==
+
== Metabolite MI-HEXAKISPHOSPHATE ==
 
* common-name:
 
* common-name:
** ethylnitronate
+
** phytate
 
* smiles:
 
* smiles:
** cc=n(=o)[o-]
+
** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1)
 
* inchi-key:
 
* inchi-key:
** yerbbvnyiklxdm-uhfffaoysa-n
+
** imqlkjbteoyosi-gpivlxjgsa-b
 
* molecular-weight:
 
* molecular-weight:
** 74.059
+
** 647.942
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-NITROPROPANE-DIOXYGENASE-RXN]]
+
* [[2.7.1.152-RXN]]
 +
* [[RXN-10971]]
 +
* [[RXN-10972]]
 +
* [[RXN-10977]]
 +
* [[RXN-10978]]
 +
* [[RXN-7186]]
 +
* [[RXN-7241]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10964]]
 +
* [[RXN-10977]]
 +
* [[RXN-10978]]
 +
* [[RXN-7163]]
 +
* [[RXN-7186]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ethylnitronate}}
+
{{#set: common-name=phytate}}
{{#set: inchi-key=inchikey=yerbbvnyiklxdm-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=imqlkjbteoyosi-gpivlxjgsa-b}}
{{#set: molecular-weight=74.059}}
+
{{#set: molecular-weight=647.942}}

Revision as of 18:57, 14 January 2021

Metabolite MI-HEXAKISPHOSPHATE

  • common-name:
    • phytate
  • smiles:
    • c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1)
  • inchi-key:
    • imqlkjbteoyosi-gpivlxjgsa-b
  • molecular-weight:
    • 647.942

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality