Difference between revisions of "DNA-N"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OROTIDINE-5-PHOSPHATE == * common-name: ** orotidine 5'-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)n...") |
(Created page with "Category:metabolite == Metabolite P-AMINO-BENZOATE == * common-name: ** 4-aminobenzoate * smiles: ** c(=o)([o-])c1(c=cc(=cc=1)n) * inchi-key: ** alynczndiqevrv-uhfffaoysa-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite P-AMINO-BENZOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-aminobenzoate |
* smiles: | * smiles: | ||
| − | ** c | + | ** c(=o)([o-])c1(c=cc(=cc=1)n) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** alynczndiqevrv-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 136.13 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ADCLY-RXN]] |
| − | * [[ | + | * [[H2PTEROATESYNTH-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ADCLY-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-aminobenzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=alynczndiqevrv-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=136.13}} |
Revision as of 18:57, 14 January 2021
Contents
Metabolite P-AMINO-BENZOATE
- common-name:
- 4-aminobenzoate
- smiles:
- c(=o)([o-])c1(c=cc(=cc=1)n)
- inchi-key:
- alynczndiqevrv-uhfffaoysa-m
- molecular-weight:
- 136.13
